C16H15NOS3 — CID 94133848
2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-4H-3,1-benzothiazine (PubChem CID 94133848) has the molecular formula C16H15NOS3 and a molecular weight of 333.50 g/mol. Its IUPAC name is 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-4H-3,1-benzothiazine.
| Compound Name | 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-4H-3,1-benzothiazine |
|---|---|
| PubChem CID | 94133848 |
| Molecular Formula | C16H15NOS3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-4H-3,1-benzothiazine |
| SMILES | O=[S@@](CCSC1=Nc2ccccc2CS1)c1ccccc1 |
| InChI | InChI=1S/C16H15NOS3/c18-21(14-7-2-1-3-8-14)11-10-19-16-17-15-9-5-4-6-13(15)12-20-16/h1-9H,10-12H2/t21-/m0/s1 |
| InChIKey | LSBWGMOUBSSEFE-NRFANRHFSA-N |
| XLogP | 4.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |