C23H20N2O2S — CID 94162780
2-[2-[(4aR,10aS)-10-methyl-4a,10a-dihydrophenothiazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 94162780) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[2-[(4aR,10aS)-10-methyl-4a,10a-dihydrophenothiazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4aR,10aS)-10-methyl-4a,10a-dihydrophenothiazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 94162780 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[2-[(4aR,10aS)-10-methyl-4a,10a-dihydrophenothiazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | CN1c2ccccc2S[C@@H]2C=CC(CCN3C(=O)c4ccccc4C3=O)=C[C@@H]21 |
| InChI | InChI=1S/C23H20N2O2S/c1-24-18-8-4-5-9-20(18)28-21-11-10-15(14-19(21)24)12-13-25-22(26)16-6-2-3-7-17(16)23(25)27/h2-11,14,19,21H,12-13H2,1H3/t19-,21+/m0/s1 |
| InChIKey | CLJYTWXMEAQEJM-PZJWPPBQSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|