C14H20N4O3S — CID 94171885
1-[(2R)-2-cyanopropyl]-1-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]urea (PubChem CID 94171885) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(2R)-2-cyanopropyl]-1-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-[(2R)-2-cyanopropyl]-1-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 94171885 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(2R)-2-cyanopropyl]-1-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]urea |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)N(C)C[C@@H](C)C#N)c1 |
| InChI | InChI=1S/C14H20N4O3S/c1-11(8-15)10-18(3)14(19)17-9-12-5-4-6-13(7-12)22(20,21)16-2/h4-7,11,16H,9-10H2,1-3H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | JQSQUTZQWHPUGY-NSHDSACASA-N |
| XLogP | 0.90 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |