C15H23N3O5S — CID 122009600
3-[[3-(dimethylsulfamoyl)phenyl]methylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122009600) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[[3-(dimethylsulfamoyl)phenyl]methylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[3-(dimethylsulfamoyl)phenyl]methylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122009600 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[[3-(dimethylsulfamoyl)phenyl]methylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)NCc1cccc(S(=O)(=O)N(C)C)c1)C(=O)O |
| InChI | InChI=1S/C15H23N3O5S/c1-11(14(19)20)10-18(4)15(21)16-9-12-6-5-7-13(8-12)24(22,23)17(2)3/h5-8,11H,9-10H2,1-4H3,(H,16,21)(H,19,20) |
| InChIKey | TYRZIDMXBBRSAO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |