C15H19ClN2O2 — CID 94179418
(3S,5S)-3-[4-(3-chlorophenyl)piperazin-1-yl]-5-methyloxolan-2-one (PubChem CID 94179418) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (3S,5S)-3-[4-(3-chlorophenyl)piperazin-1-yl]-5-methyloxolan-2-one.
| Compound Name | (3S,5S)-3-[4-(3-chlorophenyl)piperazin-1-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 94179418 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3S,5S)-3-[4-(3-chlorophenyl)piperazin-1-yl]-5-methyloxolan-2-one |
| SMILES | C[C@H]1C[C@H](N2CCN(c3cccc(Cl)c3)CC2)C(=O)O1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-11-9-14(15(19)20-11)18-7-5-17(6-8-18)13-4-2-3-12(16)10-13/h2-4,10-11,14H,5-9H2,1H3/t11-,14-/m0/s1 |
| InChIKey | KMGRHONINIQVDJ-FZMZJTMJSA-N |
| XLogP | 2.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |