C17H16N4OS — CID 94183056
N-[3-[(1S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]phenyl]benzamide (PubChem CID 94183056) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[3-[(1S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]phenyl]benzamide.
| Compound Name | N-[3-[(1S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 94183056 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[3-[(1S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]phenyl]benzamide |
| SMILES | C[C@H](Sc1ncn[nH]1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-12(23-17-18-11-19-21-17)14-8-5-9-15(10-14)20-16(22)13-6-3-2-4-7-13/h2-12H,1H3,(H,20,22)(H,18,19,21)/t12-/m0/s1 |
| InChIKey | OJRMUYPHKJXUJL-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |