C21H22ClN3O4 — CID 9430179
4-acetamido-N-[(2R,3R)-3-chloro-2-(4-methylphenyl)-4-oxoazetidin-1-yl]-2-ethoxybenzamide (PubChem CID 9430179) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 4-acetamido-N-[(2R,3R)-3-chloro-2-(4-methylphenyl)-4-oxoazetidin-1-yl]-2-ethoxybenzamide.
| Compound Name | 4-acetamido-N-[(2R,3R)-3-chloro-2-(4-methylphenyl)-4-oxoazetidin-1-yl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 9430179 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-acetamido-N-[(2R,3R)-3-chloro-2-(4-methylphenyl)-4-oxoazetidin-1-yl]-2-ethoxybenzamide |
| SMILES | CCOc1cc(NC(C)=O)ccc1C(=O)NN1C(=O)[C@H](Cl)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22ClN3O4/c1-4-29-17-11-15(23-13(3)26)9-10-16(17)20(27)24-25-19(18(22)21(25)28)14-7-5-12(2)6-8-14/h5-11,18-19H,4H2,1-3H3,(H,23,26)(H,24,27)/t18-,19-/m1/s1 |
| InChIKey | KLYGNBXNPYWCON-RTBURBONSA-N |
| XLogP | 3.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|