C22H29FN3O3+ — CID 9432269
(3-fluoro-4-methoxyphenyl)methyl-methyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 9432269) has the molecular formula C22H29FN3O3+ and a molecular weight of 402.49 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl-methyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl-methyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9432269 |
| Molecular Formula | C22H29FN3O3+ |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl-methyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | COc1ccc(C[NH+](C)[C@@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1F |
| InChI | InChI=1S/C22H28FN3O3/c1-16(25(2)15-17-4-9-21(28-3)20(23)14-17)22(27)24-18-5-7-19(8-6-18)26-10-12-29-13-11-26/h4-9,14,16H,10-13,15H2,1-3H3,(H,24,27)/p+1/t16-/m0/s1 |
| InChIKey | DNLXXFDNGMESAO-INIZCTEOSA-O |
| XLogP | 1.71 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|