C18H15N3O3S2 — CID 94345269
[2-(3-nitrophenyl)-1,3-thiazol-4-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone (PubChem CID 94345269) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-1,3-thiazol-4-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | [2-(3-nitrophenyl)-1,3-thiazol-4-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 94345269 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [2-(3-nitrophenyl)-1,3-thiazol-4-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1csc(-c2cccc([N+](=O)[O-])c2)n1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C18H15N3O3S2/c22-18(20-7-2-5-16(20)13-6-8-25-10-13)15-11-26-17(19-15)12-3-1-4-14(9-12)21(23)24/h1,3-4,6,8-11,16H,2,5,7H2/t16-/m1/s1 |
| InChIKey | FYFOHIDEIANYPU-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|