C18H16N4O3S — CID 51949223
[1-(3-nitrophenyl)pyrazol-3-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone (PubChem CID 51949223) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is [1-(3-nitrophenyl)pyrazol-3-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | [1-(3-nitrophenyl)pyrazol-3-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51949223 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [1-(3-nitrophenyl)pyrazol-3-yl]-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C18H16N4O3S/c23-18(20-8-2-5-17(20)13-7-10-26-12-13)16-6-9-21(19-16)14-3-1-4-15(11-14)22(24)25/h1,3-4,6-7,9-12,17H,2,5,8H2/t17-/m1/s1 |
| InChIKey | NUXRSSSHMZADEG-QGZVFWFLSA-N |
| XLogP | 3.82 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|