C22H20N2O5 — CID 9441714
N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(furan-2-yl)propanoylamino]benzamide (PubChem CID 9441714) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(furan-2-yl)propanoylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(furan-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 9441714 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(furan-2-yl)propanoylamino]benzamide |
| SMILES | O=C(CCc1ccco1)Nc1ccccc1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20N2O5/c25-21(10-8-16-4-3-11-27-16)24-18-6-2-1-5-17(18)22(26)23-13-15-7-9-19-20(12-15)29-14-28-19/h1-7,9,11-12H,8,10,13-14H2,(H,23,26)(H,24,25) |
| InChIKey | QBIAXAYQNMNAHE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |