C13H7NO4S — CID 945075
[4-oxo-3-(1,3-thiazol-4-yl)chromen-7-yl] formate (PubChem CID 945075) has the molecular formula C13H7NO4S and a molecular weight of 273.27 g/mol. Its IUPAC name is [4-oxo-3-(1,3-thiazol-4-yl)chromen-7-yl] formate.
| Compound Name | [4-oxo-3-(1,3-thiazol-4-yl)chromen-7-yl] formate |
|---|---|
| PubChem CID | 945075 |
| Molecular Formula | C13H7NO4S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | [4-oxo-3-(1,3-thiazol-4-yl)chromen-7-yl] formate |
| SMILES | O=COc1ccc2c(=O)c(-c3cscn3)coc2c1 |
| InChI | InChI=1S/C13H7NO4S/c15-7-18-8-1-2-9-12(3-8)17-4-10(13(9)16)11-5-19-6-14-11/h1-7H |
| InChIKey | ULZMIOUKLDORNF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|