C15H23ClN3O2+ — CID 9453401
[(2S)-4-(4-chloroanilino)-4-oxobutan-2-yl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9453401) has the molecular formula C15H23ClN3O2+ and a molecular weight of 312.82 g/mol. Its IUPAC name is [(2S)-4-(4-chloroanilino)-4-oxobutan-2-yl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(2S)-4-(4-chloroanilino)-4-oxobutan-2-yl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9453401 |
| Molecular Formula | C15H23ClN3O2+ |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [(2S)-4-(4-chloroanilino)-4-oxobutan-2-yl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CCNC(=O)[C@H](C)[NH2+][C@@H](C)CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-4-17-15(21)11(3)18-10(2)9-14(20)19-13-7-5-12(16)6-8-13/h5-8,10-11,18H,4,9H2,1-3H3,(H,17,21)(H,19,20)/p+1/t10-,11-/m0/s1 |
| InChIKey | CFYIORFWSJOTBA-QWRGUYRKSA-O |
| XLogP | 1.15 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |