About [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine
[(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine (PubChem CID 94556777) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine.
Molecular Properties
| Compound Name | [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine |
| PubChem CID | 94556777 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine |
| SMILES | NC[C@@H]1C[C@H]1c1ccsc1 |
| InChI | InChI=1S/C8H11NS/c9-4-7-3-8(7)6-1-2-10-5-6/h1-2,5,7-8H,3-4,9H2/t7-,8-/m0/s1 |
| InChIKey | ZVUHVWYTQNSLTB-YUMQZZPRSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine?
The IUPAC name of [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine (CID 94556777) is [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine.
What is the SMILES notation for [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine?
The canonical SMILES for [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine is NC[C@@H]1C[C@H]1c1ccsc1.
What is the InChIKey of [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine?
The InChIKey is ZVUHVWYTQNSLTB-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H11NS/c9-4-7-3-8(7)6-1-2-10-5-6/h1-2,5,7-8H,3-4,9H2/t7-,8-/m0/s1.
What are the key properties of [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine?
[(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine has a molecular weight of 153.25 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-thiophen-3-ylcyclopropyl]methanamine is sourced from PubChem (CID 94556777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).