C21H25N7O2 — CID 9462408
N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 9462408) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9462408 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | COCCCn1c(C)c(C)c(C#N)c1NC(=O)Cn1nnc(-c2ccccc2C)n1 |
| InChI | InChI=1S/C21H25N7O2/c1-14-8-5-6-9-17(14)20-24-26-28(25-20)13-19(29)23-21-18(12-22)15(2)16(3)27(21)10-7-11-30-4/h5-6,8-9H,7,10-11,13H2,1-4H3,(H,23,29) |
| InChIKey | PYSIQRCFGHAYBV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|