C23H32N5O3+ — CID 9432508
N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9432508) has the molecular formula C23H32N5O3+ and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9432508 |
| Molecular Formula | C23H32N5O3+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[3-cyano-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COCCCn1c(C)c(C)c(C#N)c1NC(=O)C[NH+]1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H31N5O3/c1-17-18(2)28(9-6-14-31-3)23(19(17)15-24)25-22(30)16-26-10-12-27(13-11-26)20-7-4-5-8-21(20)29/h4-5,7-8,29H,6,9-14,16H2,1-3H3,(H,25,30)/p+1 |
| InChIKey | KARYMESBQMISLC-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|