C17H23NO3S — CID 94635159
2-cyclohexylidene-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 94635159) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 2-cyclohexylidene-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-cyclohexylidene-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 94635159 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-cyclohexylidene-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)C=C1CCCCC1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-13(15-8-10-16(11-9-15)22(2,20)21)18-17(19)12-14-6-4-3-5-7-14/h8-13H,3-7H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | JLNYLHXVYUDYBD-ZDUSSCGKSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|