About (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide
(2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide (PubChem CID 94643888) has the molecular formula C18H21BrN2O2
and a molecular weight of 377.28 g/mol. Its IUPAC name is (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide |
| PubChem CID | 94643888 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide |
| SMILES | C#CCN1CCCC[C@@H]1C(=O)N[C@@H]1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H21BrN2O2/c1-2-9-21-10-4-3-5-16(21)18(22)20-15-8-11-23-17-7-6-13(19)12-14(15)17/h1,6-7,12,15-16H,3-5,8-11H2,(H,20,22)/t15-,16-/m1/s1 |
| InChIKey | MHVPASJNLKFXTQ-HZPDHXFCSA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide?
The IUPAC name of (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide (CID 94643888) is (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide.
What is the SMILES notation for (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide?
The canonical SMILES for (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide is C#CCN1CCCC[C@@H]1C(=O)N[C@@H]1CCOc2ccc(Br)cc21.
What is the InChIKey of (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide?
The InChIKey is MHVPASJNLKFXTQ-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H21BrN2O2/c1-2-9-21-10-4-3-5-16(21)18(22)20-15-8-11-23-17-7-6-13(19)12-14(15)17/h1,6-7,12,15-16H,3-5,8-11H2,(H,20,22)/t15-,16-/m1/s1.
What are the key properties of (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide?
(2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide has a molecular weight of 377.28 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(4R)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-1-prop-2-ynylpiperidine-2-carboxamide is sourced from PubChem (CID 94643888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).