C15H24N4O3S — CID 94657727
(3R)-1-N-(4-methoxybutyl)-3-N-(1,3-thiazol-2-yl)piperidine-1,3-dicarboxamide (PubChem CID 94657727) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3R)-1-N-(4-methoxybutyl)-3-N-(1,3-thiazol-2-yl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(4-methoxybutyl)-3-N-(1,3-thiazol-2-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94657727 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3R)-1-N-(4-methoxybutyl)-3-N-(1,3-thiazol-2-yl)piperidine-1,3-dicarboxamide |
| SMILES | COCCCCNC(=O)N1CCC[C@@H](C(=O)Nc2nccs2)C1 |
| InChI | InChI=1S/C15H24N4O3S/c1-22-9-3-2-6-17-15(21)19-8-4-5-12(11-19)13(20)18-14-16-7-10-23-14/h7,10,12H,2-6,8-9,11H2,1H3,(H,17,21)(H,16,18,20)/t12-/m1/s1 |
| InChIKey | BGMHVLWEOVPQAL-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|