C18H7F5N2O — CID 9466512
(2Z)-2-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]acenaphthylen-1-one (PubChem CID 9466512) has the molecular formula C18H7F5N2O and a molecular weight of 362.26 g/mol. Its IUPAC name is (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]acenaphthylen-1-one.
| Compound Name | (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]acenaphthylen-1-one |
|---|---|
| PubChem CID | 9466512 |
| Molecular Formula | C18H7F5N2O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]acenaphthylen-1-one |
| SMILES | O=C1/C(=N\Nc2c(F)c(F)c(F)c(F)c2F)c2cccc3cccc1c23 |
| InChI | InChI=1S/C18H7F5N2O/c19-11-12(20)14(22)17(15(23)13(11)21)25-24-16-8-5-1-3-7-4-2-6-9(10(7)8)18(16)26/h1-6,25H/b24-16- |
| InChIKey | FWJOZKSBJDTZDC-JLPGSUDCSA-N |
| XLogP | 4.55 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|