C17H23N3O3 — CID 9468163
N'-(2,5-dimethylfuran-3-carbonyl)-2,5-dimethyl-1-propan-2-ylpyrrole-3-carbohydrazide (PubChem CID 9468163) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-2,5-dimethyl-1-propan-2-ylpyrrole-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-2,5-dimethyl-1-propan-2-ylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 9468163 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-2,5-dimethyl-1-propan-2-ylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(C)n(C(C)C)c2C)c(C)o1 |
| InChI | InChI=1S/C17H23N3O3/c1-9(2)20-10(3)7-14(12(20)5)16(21)18-19-17(22)15-8-11(4)23-13(15)6/h7-9H,1-6H3,(H,18,21)(H,19,22) |
| InChIKey | SQINMANGHZIMIM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|