C20H29N2O3+ — CID 9473020
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide (PubChem CID 9473020) has the molecular formula C20H29N2O3+ and a molecular weight of 345.46 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 9473020 |
| Molecular Formula | C20H29N2O3+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H28N2O3/c1-16-5-2-3-11-22(16)12-4-10-21-20(23)9-7-17-6-8-18-19(15-17)25-14-13-24-18/h6-9,15-16H,2-5,10-14H2,1H3,(H,21,23)/p+1/b9-7+/t16-/m0/s1 |
| InChIKey | GIHNZGQKEGFQRV-DYLHUKMJSA-O |
| XLogP | 1.43 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|