C18H25ClFN2O+ — CID 9473306
(E)-3-(3-chloro-4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide (PubChem CID 9473306) has the molecular formula C18H25ClFN2O+ and a molecular weight of 339.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 9473306 |
| Molecular Formula | C18H25ClFN2O+ |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]prop-2-enamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H24ClFN2O/c1-14-5-2-3-11-22(14)12-4-10-21-18(23)9-7-15-6-8-17(20)16(19)13-15/h6-9,13-14H,2-5,10-12H2,1H3,(H,21,23)/p+1/b9-7+/t14-/m0/s1 |
| InChIKey | GUDBIYGKPOOKNQ-KGXGESDWSA-O |
| XLogP | 2.46 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|