C16H23F2N3O — CID 94749356
2-[2-(5,6-difluoro-2-pentan-3-ylbenzimidazol-1-yl)ethoxy]ethanamine (PubChem CID 94749356) has the molecular formula C16H23F2N3O and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[2-(5,6-difluoro-2-pentan-3-ylbenzimidazol-1-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(5,6-difluoro-2-pentan-3-ylbenzimidazol-1-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 94749356 |
| Molecular Formula | C16H23F2N3O |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-[2-(5,6-difluoro-2-pentan-3-ylbenzimidazol-1-yl)ethoxy]ethanamine |
| SMILES | CCC(CC)c1nc2cc(F)c(F)cc2n1CCOCCN |
| InChI | InChI=1S/C16H23F2N3O/c1-3-11(4-2)16-20-14-9-12(17)13(18)10-15(14)21(16)6-8-22-7-5-19/h9-11H,3-8,19H2,1-2H3 |
| InChIKey | SOWZPZSUHNNNSK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|