About 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine
2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine (PubChem CID 82146150) has the molecular formula C14H17F2N3O
and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine |
| PubChem CID | 82146150 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine |
| SMILES | NCCOCCn1c(C2CC2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C14H17F2N3O/c15-10-7-12-13(8-11(10)16)19(4-6-20-5-3-17)14(18-12)9-1-2-9/h7-9H,1-6,17H2 |
| InChIKey | VFSAPKHXVJHWOW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine?
The IUPAC name of 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine (CID 82146150) is 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine.
What is the SMILES notation for 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine?
The canonical SMILES for 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine is NCCOCCn1c(C2CC2)nc2cc(F)c(F)cc21.
What is the InChIKey of 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine?
The InChIKey is VFSAPKHXVJHWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3O/c15-10-7-12-13(8-11(10)16)19(4-6-20-5-3-17)14(18-12)9-1-2-9/h7-9H,1-6,17H2.
What are the key properties of 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine?
2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine has a molecular weight of 281.31 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-cyclopropyl-5,6-difluorobenzimidazol-1-yl)ethoxy]ethanamine is sourced from PubChem (CID 82146150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).