C15H19F2N3 — CID 82146331
1-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)butan-2-amine (PubChem CID 82146331) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is 1-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)butan-2-amine.
| Compound Name | 1-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 82146331 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)butan-2-amine |
| SMILES | CCC(N)Cn1c(C2CCC2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H19F2N3/c1-2-10(18)8-20-14-7-12(17)11(16)6-13(14)19-15(20)9-4-3-5-9/h6-7,9-10H,2-5,8,18H2,1H3 |
| InChIKey | GKRFAEQSLDHYTF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |