C15H15F2N3 — CID 82146172
2-(2-cyclohexyl-5,6-difluorobenzimidazol-1-yl)acetonitrile (PubChem CID 82146172) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(2-cyclohexyl-5,6-difluorobenzimidazol-1-yl)acetonitrile.
| Compound Name | 2-(2-cyclohexyl-5,6-difluorobenzimidazol-1-yl)acetonitrile |
|---|---|
| PubChem CID | 82146172 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(2-cyclohexyl-5,6-difluorobenzimidazol-1-yl)acetonitrile |
| SMILES | N#CCn1c(C2CCCCC2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H15F2N3/c16-11-8-13-14(9-12(11)17)20(7-6-18)15(19-13)10-4-2-1-3-5-10/h8-10H,1-5,7H2 |
| InChIKey | KSTWXJMSKYTVSH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |