C15H26N4O3 — CID 94753758
3-[2-(2-aminoethoxy)ethyl]-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 94753758) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethyl]-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(2-aminoethoxy)ethyl]-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 94753758 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethyl]-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C=C(C)CN1CCC2(CC1)NC(=O)N(CCOCCN)C2=O |
| InChI | InChI=1S/C15H26N4O3/c1-12(2)11-18-6-3-15(4-7-18)13(20)19(14(21)17-15)8-10-22-9-5-16/h1,3-11,16H2,2H3,(H,17,21) |
| InChIKey | WRXMLXZUICWOLN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|