C15H26N4O2 — CID 82148502
3-(2-aminobutyl)-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 82148502) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-(2-aminobutyl)-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2-aminobutyl)-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 82148502 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-(2-aminobutyl)-8-(2-methylprop-2-enyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C=C(C)CN1CCC2(CC1)NC(=O)N(CC(N)CC)C2=O |
| InChI | InChI=1S/C15H26N4O2/c1-4-12(16)10-19-13(20)15(17-14(19)21)5-7-18(8-6-15)9-11(2)3/h12H,2,4-10,16H2,1,3H3,(H,17,21) |
| InChIKey | UXBGXXFSDNIUJE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|