C16H22FN3O3S — CID 9476134
2-[[2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-methylamino]-N-propan-2-ylacetamide (PubChem CID 9476134) has the molecular formula C16H22FN3O3S and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[[2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 9476134 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[[2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetyl]-methylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)CSCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H22FN3O3S/c1-11(2)18-14(21)8-20(3)16(23)10-24-9-15(22)19-13-7-5-4-6-12(13)17/h4-7,11H,8-10H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | XQNOECRRCGQWER-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |