C20H16FN3O2 — CID 94782021
(5R)-5-benzyl-3-[(5-fluoroquinolin-8-yl)methyl]imidazolidine-2,4-dione (PubChem CID 94782021) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[(5-fluoroquinolin-8-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[(5-fluoroquinolin-8-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94782021 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (5R)-5-benzyl-3-[(5-fluoroquinolin-8-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2ccccc2)C(=O)N1Cc1ccc(F)c2cccnc12 |
| InChI | InChI=1S/C20H16FN3O2/c21-16-9-8-14(18-15(16)7-4-10-22-18)12-24-19(25)17(23-20(24)26)11-13-5-2-1-3-6-13/h1-10,17H,11-12H2,(H,23,26)/t17-/m1/s1 |
| InChIKey | NHBQAWXGCVPBPM-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|