C15H19N3O4S — CID 94811742
methyl (2S)-2-methyl-3-[methyl-(1-phenylpyrazol-4-yl)sulfonylamino]propanoate (PubChem CID 94811742) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl (2S)-2-methyl-3-[methyl-(1-phenylpyrazol-4-yl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-2-methyl-3-[methyl-(1-phenylpyrazol-4-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 94811742 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl (2S)-2-methyl-3-[methyl-(1-phenylpyrazol-4-yl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)CN(C)S(=O)(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H19N3O4S/c1-12(15(19)22-3)10-17(2)23(20,21)14-9-16-18(11-14)13-7-5-4-6-8-13/h4-9,11-12H,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | UXKBKRYUCSLOPB-LBPRGKRZSA-N |
| XLogP | 1.30 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |