About (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide
(2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide (PubChem CID 94814555) has the molecular formula C16H20N2O4S
and a molecular weight of 336.41 g/mol. Its IUPAC name is (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide.
Molecular Properties
| Compound Name | (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
| PubChem CID | 94814555 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@H]1CCCCO1)C(=O)Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C16H20N2O4S/c1-11(22-9-12-5-2-3-7-20-12)15(19)18-16-17-13(10-23-16)14-6-4-8-21-14/h4,6,8,10-12H,2-3,5,7,9H2,1H3,(H,17,18,19)/t11-,12+/m0/s1 |
| InChIKey | RCAUCPPYZJRHTR-NWDGAFQWSA-N |
| XLogP | 3.32 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide?
The IUPAC name of (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide (CID 94814555) is (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide.
What is the SMILES notation for (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide?
The canonical SMILES for (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide is C[C@H](OC[C@H]1CCCCO1)C(=O)Nc1nc(-c2ccco2)cs1.
What is the InChIKey of (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide?
The InChIKey is RCAUCPPYZJRHTR-NWDGAFQWSA-N. The full InChI is InChI=1S/C16H20N2O4S/c1-11(22-9-12-5-2-3-7-20-12)15(19)18-16-17-13(10-23-16)14-6-4-8-21-14/h4,6,8,10-12H,2-3,5,7,9H2,1H3,(H,17,18,19)/t11-,12+/m0/s1.
What are the key properties of (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide?
(2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide has a molecular weight of 336.41 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide is sourced from PubChem (CID 94814555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).