C17H26N2O3S — CID 94820526
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(4-methyl-N-propan-2-ylanilino)acetamide (PubChem CID 94820526) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(4-methyl-N-propan-2-ylanilino)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(4-methyl-N-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 94820526 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(4-methyl-N-propan-2-ylanilino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)N(C)[C@@H]2CCS(=O)(=O)C2)C(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-13(2)19(15-7-5-14(3)6-8-15)11-17(20)18(4)16-9-10-23(21,22)12-16/h5-8,13,16H,9-12H2,1-4H3/t16-/m1/s1 |
| InChIKey | FRJQJPQFXGUCAM-MRXNPFEDSA-N |
| XLogP | 1.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|