C12H12F6N2O2 — CID 948231
1-(2-hydroxyphenyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea (PubChem CID 948231) has the molecular formula C12H12F6N2O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea.
| Compound Name | 1-(2-hydroxyphenyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 948231 |
| Molecular Formula | C12H12F6N2O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(2-hydroxyphenyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
| SMILES | CCC(NC(=O)Nc1ccccc1O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6N2O2/c1-2-10(11(13,14)15,12(16,17)18)20-9(22)19-7-5-3-4-6-8(7)21/h3-6,21H,2H2,1H3,(H2,19,20,22) |
| InChIKey | VOODCJBMEXPKRW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|