C23H20ClNO4 — CID 94846981
methyl (4Z)-1-(4-chlorophenyl)-2-methyl-5-oxo-4-[(3-prop-2-enoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 94846981) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is methyl (4Z)-1-(4-chlorophenyl)-2-methyl-5-oxo-4-[(3-prop-2-enoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(4-chlorophenyl)-2-methyl-5-oxo-4-[(3-prop-2-enoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94846981 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | methyl (4Z)-1-(4-chlorophenyl)-2-methyl-5-oxo-4-[(3-prop-2-enoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | C=CCOc1cccc(/C=C2\C(=O)N(c3ccc(Cl)cc3)C(C)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C23H20ClNO4/c1-4-12-29-19-7-5-6-16(13-19)14-20-21(23(27)28-3)15(2)25(22(20)26)18-10-8-17(24)9-11-18/h4-11,13-14H,1,12H2,2-3H3/b20-14- |
| InChIKey | GOEGVEWPACHNHW-ZHZULCJRSA-N |
| XLogP | 4.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|