C14H17N5O4 — CID 94935487
1-(2-amino-2-oxoethyl)-5-(3-amino-4-propoxyphenyl)triazole-4-carboxylic acid (PubChem CID 94935487) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-5-(3-amino-4-propoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-amino-2-oxoethyl)-5-(3-amino-4-propoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94935487 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-5-(3-amino-4-propoxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCCOc1ccc(-c2c(C(=O)O)nnn2CC(N)=O)cc1N |
| InChI | InChI=1S/C14H17N5O4/c1-2-5-23-10-4-3-8(6-9(10)15)13-12(14(21)22)17-18-19(13)7-11(16)20/h3-4,6H,2,5,7,15H2,1H3,(H2,16,20)(H,21,22) |
| InChIKey | XREBFIZBQGOTIO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|