4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid

C13H14N2O3S — CID 82225738

IUPAC4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCCOc1ccc(-c2ncsc2C(=O)O)cc1N
InChIInChI=1S/C13H14N2O3S/c1-2-5-18-10-4-3-8(6-9(10)14)11-12(13(16)17)19-7-15-11/h3-4,6-7H,2,5,14H2,1H3,(H,16,17)
InChIKeyYCEIVFFFEQIAIA-UHFFFAOYSA-N
MW278.33 g/mol
LogP2.88
Rot. Bonds5

About 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid

4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82225738) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid
PubChem CID82225738
Molecular FormulaC13H14N2O3S
Molecular Weight278.33 g/mol
Exact Mass278.07
IUPAC Name4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCCOc1ccc(-c2ncsc2C(=O)O)cc1N
InChIInChI=1S/C13H14N2O3S/c1-2-5-18-10-4-3-8(6-9(10)14)11-12(13(16)17)19-7-15-11/h3-4,6-7H,2,5,14H2,1H3,(H,16,17)
InChIKeyYCEIVFFFEQIAIA-UHFFFAOYSA-N
XLogP2.88
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.33
LogP ≤ 52.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid (CID 82225738) is 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid is CCCOc1ccc(-c2ncsc2C(=O)O)cc1N.
What is the InChIKey of 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is YCEIVFFFEQIAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-2-5-18-10-4-3-8(6-9(10)14)11-12(13(16)17)19-7-15-11/h3-4,6-7H,2,5,14H2,1H3,(H,16,17).
What are the key properties of 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid?
4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 278.33 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-4-propoxyphenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82225738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).