C23H34N2O7S — CID 9498043
diethyl (3R,4R)-3-hexyl-4-[(4-methylphenyl)sulfonylamino]-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 9498043) has the molecular formula C23H34N2O7S and a molecular weight of 482.60 g/mol. Its IUPAC name is diethyl (3R,4R)-3-hexyl-4-[(4-methylphenyl)sulfonylamino]-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4R)-3-hexyl-4-[(4-methylphenyl)sulfonylamino]-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 9498043 |
| Molecular Formula | C23H34N2O7S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | diethyl (3R,4R)-3-hexyl-4-[(4-methylphenyl)sulfonylamino]-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | CCCCCC[C@@H]1[C@@H](NS(=O)(=O)c2ccc(C)cc2)C(=O)NC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H34N2O7S/c1-5-8-9-10-11-18-19(25-33(29,30)17-14-12-16(4)13-15-17)20(26)24-23(18,21(27)31-6-2)22(28)32-7-3/h12-15,18-19,25H,5-11H2,1-4H3,(H,24,26)/t18-,19-/m1/s1 |
| InChIKey | SOTFOKJNYMYWFR-RTBURBONSA-N |
| XLogP | 2.22 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|