C14H20N2O6 — CID 95048921
1-O-tert-butyl 2-O-[(3R)-2,5-dioxopyrrolidin-3-yl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 95048921) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(3R)-2,5-dioxopyrrolidin-3-yl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(3R)-2,5-dioxopyrrolidin-3-yl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 95048921 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(3R)-2,5-dioxopyrrolidin-3-yl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O[C@@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C14H20N2O6/c1-14(2,3)22-13(20)16-6-4-5-8(16)12(19)21-9-7-10(17)15-11(9)18/h8-9H,4-7H2,1-3H3,(H,15,17,18)/t8-,9+/m0/s1 |
| InChIKey | SNZJUSWCTUVMKZ-DTWKUNHWSA-N |
| XLogP | 0.34 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|