C25H24N4O6 — CID 95059673
(13S)-13-(4-methoxyphenyl)-3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 95059673) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is (13S)-13-(4-methoxyphenyl)-3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-13-(4-methoxyphenyl)-3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 95059673 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (13S)-13-(4-methoxyphenyl)-3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | COc1ccc([C@@H]2OCCn3c(-c4ccc(C)c([N+](=O)[O-])c4)c4c(=O)n(C)c(=O)n(C)c4c32)cc1 |
| InChI | InChI=1S/C25H24N4O6/c1-14-5-6-16(13-18(14)29(32)33)20-19-21(26(2)25(31)27(3)24(19)30)22-23(35-12-11-28(20)22)15-7-9-17(34-4)10-8-15/h5-10,13,23H,11-12H2,1-4H3/t23-/m0/s1 |
| InChIKey | JQTCOTNVHBPTMM-QHCPKHFHSA-N |
| XLogP | 3.05 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|