C27H28N4O5 — CID 53044183
3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-13-(4-propan-2-ylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 53044183) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-13-(4-propan-2-ylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | 3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-13-(4-propan-2-ylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 53044183 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3,5-dimethyl-8-(4-methyl-3-nitrophenyl)-13-(4-propan-2-ylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3n2CCOC3c2ccc(C(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H28N4O5/c1-15(2)17-8-10-18(11-9-17)25-24-23-21(26(32)29(5)27(33)28(23)4)22(30(24)12-13-36-25)19-7-6-16(3)20(14-19)31(34)35/h6-11,14-15,25H,12-13H2,1-5H3 |
| InChIKey | RZNKQFDKJQWDAW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|