C23H27N3O4S2 — CID 95085029
(2S)-N-benzyl-N-methyl-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085029) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is (2S)-N-benzyl-N-methyl-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2S)-N-benzyl-N-methyl-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085029 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (2S)-N-benzyl-N-methyl-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CC1CCN(C(=O)[C@H]2Sc3ccc(S(=O)(=O)N(C)Cc4ccccc4)cc3NC2=O)CC1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-16-10-12-26(13-11-16)23(28)21-22(27)24-19-14-18(8-9-20(19)31-21)32(29,30)25(2)15-17-6-4-3-5-7-17/h3-9,14,16,21H,10-13,15H2,1-2H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | CXJSOTLXKFDXGV-NRFANRHFSA-N |
| XLogP | 3.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|