C25H30N6O — CID 95100909
(3R)-N-methyl-1-pyrido[2,3-b]pyrazin-7-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 95100909) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is (3R)-N-methyl-1-pyrido[2,3-b]pyrazin-7-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-methyl-1-pyrido[2,3-b]pyrazin-7-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95100909 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (3R)-N-methyl-1-pyrido[2,3-b]pyrazin-7-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CN(Cc1ccc(N2CCCC2)cc1)C(=O)[C@@H]1CCCN(c2cnc3nccnc3c2)C1 |
| InChI | InChI=1S/C25H30N6O/c1-29(17-19-6-8-21(9-7-19)30-12-2-3-13-30)25(32)20-5-4-14-31(18-20)22-15-23-24(28-16-22)27-11-10-26-23/h6-11,15-16,20H,2-5,12-14,17-18H2,1H3/t20-/m1/s1 |
| InChIKey | BGHYXRDOWOAQOH-HXUWFJFHSA-N |
| XLogP | 3.50 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|