C23H36N4O3S — CID 95105953
(4R)-N-(3-piperidin-1-ylpropyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 95105953) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is (4R)-N-(3-piperidin-1-ylpropyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | (4R)-N-(3-piperidin-1-ylpropyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 95105953 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (4R)-N-(3-piperidin-1-ylpropyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)[C@H]1CN(S(=O)(=O)c2cccnc2)CC12CCCCC2 |
| InChI | InChI=1S/C23H36N4O3S/c28-22(25-13-8-16-26-14-5-2-6-15-26)21-18-27(19-23(21)10-3-1-4-11-23)31(29,30)20-9-7-12-24-17-20/h7,9,12,17,21H,1-6,8,10-11,13-16,18-19H2,(H,25,28)/t21-/m1/s1 |
| InChIKey | HPMDXGAAGUPMJB-OAQYLSRUSA-N |
| XLogP | 2.64 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|