C22H34N4O3S — CID 53183521
N-(2-piperidin-1-ylethyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 53183521) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-(2-piperidin-1-ylethyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 53183521 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-2-pyridin-3-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)C1CN(S(=O)(=O)c2cccnc2)CC12CCCCC2 |
| InChI | InChI=1S/C22H34N4O3S/c27-21(24-12-15-25-13-5-2-6-14-25)20-17-26(18-22(20)9-3-1-4-10-22)30(28,29)19-8-7-11-23-16-19/h7-8,11,16,20H,1-6,9-10,12-15,17-18H2,(H,24,27) |
| InChIKey | WIKOCSJXLCBDLW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |