C20H25N3O3S2 — CID 95105965
(4S)-N-(pyridin-2-ylmethyl)-2-thiophen-2-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 95105965) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (4S)-N-(pyridin-2-ylmethyl)-2-thiophen-2-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | (4S)-N-(pyridin-2-ylmethyl)-2-thiophen-2-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 95105965 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (4S)-N-(pyridin-2-ylmethyl)-2-thiophen-2-ylsulfonyl-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)[C@@H]1CN(S(=O)(=O)c2cccs2)CC12CCCCC2 |
| InChI | InChI=1S/C20H25N3O3S2/c24-19(22-13-16-7-2-5-11-21-16)17-14-23(15-20(17)9-3-1-4-10-20)28(25,26)18-8-6-12-27-18/h2,5-8,11-12,17H,1,3-4,9-10,13-15H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | ITMIDSGCYPITAG-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |