C23H25N3O3 — CID 95113769
2-[(6aR)-2-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 95113769) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[(6aR)-2-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[(6aR)-2-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 95113769 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[(6aR)-2-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | Cc1ccc2c(c1)C(=O)N1CCC[C@@H]1C(=O)N2CC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-15-10-11-19-18(13-15)22(28)25-12-6-9-20(25)23(29)26(19)14-21(27)24-16(2)17-7-4-3-5-8-17/h3-5,7-8,10-11,13,16,20H,6,9,12,14H2,1-2H3,(H,24,27)/t16-,20-/m1/s1 |
| InChIKey | OLNKWVZYWSMWSE-OXQOHEQNSA-N |
| XLogP | 2.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |