C18H21N3O3S — CID 95123044
methyl 3-[3-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propanoylamino]thiophene-2-carboxylate (PubChem CID 95123044) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is methyl 3-[3-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propanoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[3-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 95123044 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl 3-[3-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propanoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CCN1CCC[C@H]1c1ccccn1 |
| InChI | InChI=1S/C18H21N3O3S/c1-24-18(23)17-14(8-12-25-17)20-16(22)7-11-21-10-4-6-15(21)13-5-2-3-9-19-13/h2-3,5,8-9,12,15H,4,6-7,10-11H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | IIFINQDYRDPIEB-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |