C15H20ClN3O3 — CID 95137545
(3S)-1-N-[2-[(2-chlorophenyl)methoxy]ethyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 95137545) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is (3S)-1-N-[2-[(2-chlorophenyl)methoxy]ethyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[2-[(2-chlorophenyl)methoxy]ethyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95137545 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (3S)-1-N-[2-[(2-chlorophenyl)methoxy]ethyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCN(C(=O)NCCOCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c16-13-4-2-1-3-12(13)10-22-8-6-18-15(21)19-7-5-11(9-19)14(17)20/h1-4,11H,5-10H2,(H2,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | NFHWJQUIHADQPF-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|